C18H20F2N2O4 — CID 2710467
3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(difluoromethoxy)phenyl]propanamide (PubChem CID 2710467) has the molecular formula C18H20F2N2O4 and a molecular weight of 366.36 g/mol. Its IUPAC name is 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(difluoromethoxy)phenyl]propanamide.
| Compound Name | 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(difluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 2710467 |
| Molecular Formula | C18H20F2N2O4 |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | 3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-[2-(difluoromethoxy)phenyl]propanamide |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@H]2C1=O)Nc1ccccc1OC(F)F |
| InChI | InChI=1S/C18H20F2N2O4/c19-18(20)26-14-8-4-3-7-13(14)21-15(23)9-10-22-16(24)11-5-1-2-6-12(11)17(22)25/h3-4,7-8,11-12,18H,1-2,5-6,9-10H2,(H,21,23)/t11-,12+ |
| InChIKey | RBNJRTIJIFDNHT-TXEJJXNPSA-N |
| XLogP | 2.79 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|