C18H19F3N2O4 — CID 17415232
3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(trifluoromethoxy)phenyl]propanamide (PubChem CID 17415232) has the molecular formula C18H19F3N2O4 and a molecular weight of 384.35 g/mol. Its IUPAC name is 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(trifluoromethoxy)phenyl]propanamide.
| Compound Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(trifluoromethoxy)phenyl]propanamide |
|---|---|
| PubChem CID | 17415232 |
| Molecular Formula | C18H19F3N2O4 |
| Molecular Weight | 384.35 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | 3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)-N-[2-(trifluoromethoxy)phenyl]propanamide |
| SMILES | O=C(CCN1C(=O)C2CCCCC2C1=O)Nc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C18H19F3N2O4/c19-18(20,21)27-14-8-4-3-7-13(14)22-15(24)9-10-23-16(25)11-5-1-2-6-12(11)17(23)26/h3-4,7-8,11-12H,1-2,5-6,9-10H2,(H,22,24) |
| InChIKey | BVMLQEXWAUEYTJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|