C21H27N3O3 — CID 2714752
3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 2714752) has the molecular formula C21H27N3O3 and a molecular weight of 369.47 g/mol. Its IUPAC name is 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 2714752 |
| Molecular Formula | C21H27N3O3 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.21 |
| IUPAC Name | 3-[(3aR,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]-N-(2-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@H]2C1=O)Nc1ccccc1N1CCCC1 |
| InChI | InChI=1S/C21H27N3O3/c25-19(22-17-9-3-4-10-18(17)23-12-5-6-13-23)11-14-24-20(26)15-7-1-2-8-16(15)21(24)27/h3-4,9-10,15-16H,1-2,5-8,11-14H2,(H,22,25)/t15-,16+ |
| InChIKey | RJNNCUKNWYPCOS-IYBDPMFKSA-N |
| XLogP | 2.79 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|