C21H25N3O4 — CID 2681212
2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-N-cyclopropylbenzamide (PubChem CID 2681212) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-N-cyclopropylbenzamide.
| Compound Name | 2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-N-cyclopropylbenzamide |
|---|---|
| PubChem CID | 2681212 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-N-cyclopropylbenzamide |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O)Nc1ccccc1C(=O)NC1CC1 |
| InChI | InChI=1S/C21H25N3O4/c25-18(11-12-24-20(27)14-5-1-2-6-15(14)21(24)28)23-17-8-4-3-7-16(17)19(26)22-13-9-10-13/h3-4,7-8,13-15H,1-2,5-6,9-12H2,(H,22,26)(H,23,25)/t14-,15-/m0/s1 |
| InChIKey | IFNWDFUCDYETAV-GJZGRUSLSA-N |
| XLogP | 2.08 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|