C20H22F3N3O4 — CID 43015781
2-[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoylamino]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 43015781) has the molecular formula C20H22F3N3O4 and a molecular weight of 425.41 g/mol. Its IUPAC name is 2-[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoylamino]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 2-[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoylamino]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 43015781 |
| Molecular Formula | C20H22F3N3O4 |
| Molecular Weight | 425.41 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 2-[3-(1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl)propanoylamino]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(CCN1C(=O)C2CCCCC2C1=O)Nc1ccccc1C(=O)NCC(F)(F)F |
| InChI | InChI=1S/C20H22F3N3O4/c21-20(22,23)11-24-17(28)14-7-3-4-8-15(14)25-16(27)9-10-26-18(29)12-5-1-2-6-13(12)19(26)30/h3-4,7-8,12-13H,1-2,5-6,9-11H2,(H,24,28)(H,25,27) |
| InChIKey | RYNYCALOUHWTDR-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|