C18H21FN4O3S — CID 9468653
1-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-(2-fluorophenyl)thiourea (PubChem CID 9468653) has the molecular formula C18H21FN4O3S and a molecular weight of 392.46 g/mol. Its IUPAC name is 1-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-(2-fluorophenyl)thiourea.
| Compound Name | 1-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-(2-fluorophenyl)thiourea |
|---|---|
| PubChem CID | 9468653 |
| Molecular Formula | C18H21FN4O3S |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | 1-[3-[(3aS,7aS)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-(2-fluorophenyl)thiourea |
| SMILES | O=C(CCN1C(=O)[C@H]2CCCC[C@@H]2C1=O)NNC(=S)Nc1ccccc1F |
| InChI | InChI=1S/C18H21FN4O3S/c19-13-7-3-4-8-14(13)20-18(27)22-21-15(24)9-10-23-16(25)11-5-1-2-6-12(11)17(23)26/h3-4,7-8,11-12H,1-2,5-6,9-10H2,(H,21,24)(H2,20,22,27)/t11-,12-/m0/s1 |
| InChIKey | DLAFDJNLAAFSFN-RYUDHWBXSA-N |
| XLogP | 1.71 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|