C15H24N4O3S — CID 7977975
1-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-propan-2-ylthiourea (PubChem CID 7977975) has the molecular formula C15H24N4O3S and a molecular weight of 340.45 g/mol. Its IUPAC name is 1-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-propan-2-ylthiourea.
| Compound Name | 1-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-propan-2-ylthiourea |
|---|---|
| PubChem CID | 7977975 |
| Molecular Formula | C15H24N4O3S |
| Molecular Weight | 340.45 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | 1-[3-[(3aR,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoylamino]-3-propan-2-ylthiourea |
| SMILES | CC(C)NC(=S)NNC(=O)CCN1C(=O)[C@@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C15H24N4O3S/c1-9(2)16-15(23)18-17-12(20)7-8-19-13(21)10-5-3-4-6-11(10)14(19)22/h9-11H,3-8H2,1-2H3,(H,17,20)(H2,16,18,23)/t10-,11-/m1/s1 |
| InChIKey | JOAFOWPLOKANIG-GHMZBOCLSA-N |
| XLogP | 0.46 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.45 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|