C22H29N3O5 — CID 8880495
(2R)-N'-[3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]-2-(2,3-dimethylphenoxy)propanehydrazide (PubChem CID 8880495) has the molecular formula C22H29N3O5 and a molecular weight of 415.49 g/mol. Its IUPAC name is (2R)-N'-[3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]-2-(2,3-dimethylphenoxy)propanehydrazide.
| Compound Name | (2R)-N'-[3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]-2-(2,3-dimethylphenoxy)propanehydrazide |
|---|---|
| PubChem CID | 8880495 |
| Molecular Formula | C22H29N3O5 |
| Molecular Weight | 415.49 g/mol |
| Exact Mass | 415.21 |
| IUPAC Name | (2R)-N'-[3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]-2-(2,3-dimethylphenoxy)propanehydrazide |
| SMILES | Cc1cccc(O[C@H](C)C(=O)NNC(=O)CCN2C(=O)[C@H]3CCCC[C@H]3C2=O)c1C |
| InChI | InChI=1S/C22H29N3O5/c1-13-7-6-10-18(14(13)2)30-15(3)20(27)24-23-19(26)11-12-25-21(28)16-8-4-5-9-17(16)22(25)29/h6-7,10,15-17H,4-5,8-9,11-12H2,1-3H3,(H,23,26)(H,24,27)/t15-,16-,17+/m1/s1 |
| InChIKey | LEPVPISKEFGEKQ-ZACQAIPSSA-N |
| XLogP | 1.78 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.49 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|