C27H35N3O4S — CID 55341943
N-(cyclohexylmethyl)-2-[2-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]phenyl]sulfanylacetamide (PubChem CID 55341943) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[2-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]phenyl]sulfanylacetamide.
| Compound Name | N-(cyclohexylmethyl)-2-[2-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 55341943 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[2-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]phenyl]sulfanylacetamide |
| SMILES | Cc1cccc(OC(C)C(=O)NNC(=O)c2ccccc2SCC(=O)NCC2CCCCC2)c1C |
| InChI | InChI=1S/C27H35N3O4S/c1-18-10-9-14-23(19(18)2)34-20(3)26(32)29-30-27(33)22-13-7-8-15-24(22)35-17-25(31)28-16-21-11-5-4-6-12-21/h7-10,13-15,20-21H,4-6,11-12,16-17H2,1-3H3,(H,28,31)(H,29,32)(H,30,33) |
| InChIKey | KXUOSNQYDKCZRA-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|