C21H25N3O3S2 — CID 18160095
N-(cyclohexylmethyl)-2-[2-[(thiophene-2-carbonylamino)carbamoyl]phenyl]sulfanylacetamide (PubChem CID 18160095) has the molecular formula C21H25N3O3S2 and a molecular weight of 431.58 g/mol. Its IUPAC name is N-(cyclohexylmethyl)-2-[2-[(thiophene-2-carbonylamino)carbamoyl]phenyl]sulfanylacetamide.
| Compound Name | N-(cyclohexylmethyl)-2-[2-[(thiophene-2-carbonylamino)carbamoyl]phenyl]sulfanylacetamide |
|---|---|
| PubChem CID | 18160095 |
| Molecular Formula | C21H25N3O3S2 |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | N-(cyclohexylmethyl)-2-[2-[(thiophene-2-carbonylamino)carbamoyl]phenyl]sulfanylacetamide |
| SMILES | O=C(CSc1ccccc1C(=O)NNC(=O)c1cccs1)NCC1CCCCC1 |
| InChI | InChI=1S/C21H25N3O3S2/c25-19(22-13-15-7-2-1-3-8-15)14-29-17-10-5-4-9-16(17)20(26)23-24-21(27)18-11-6-12-28-18/h4-6,9-12,15H,1-3,7-8,13-14H2,(H,22,25)(H,23,26)(H,24,27) |
| InChIKey | BXAJSWRVIQXXAZ-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|