C18H27N3O2S — CID 119384780
N-(2-aminoethyl)-2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzamide (PubChem CID 119384780) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzamide.
| Compound Name | N-(2-aminoethyl)-2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzamide |
|---|---|
| PubChem CID | 119384780 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-(2-aminoethyl)-2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanylbenzamide |
| SMILES | NCCNC(=O)c1ccccc1SCC(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C18H27N3O2S/c19-10-11-20-18(23)15-8-4-5-9-16(15)24-13-17(22)21-12-14-6-2-1-3-7-14/h4-5,8-9,14H,1-3,6-7,10-13,19H2,(H,20,23)(H,21,22) |
| InChIKey | YBUCDFBWGQWRMZ-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |