C23H34N2O2S — CID 112793176
2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanyl-N-(2-methylcyclohexyl)benzamide (PubChem CID 112793176) has the molecular formula C23H34N2O2S and a molecular weight of 402.60 g/mol. Its IUPAC name is 2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanyl-N-(2-methylcyclohexyl)benzamide.
| Compound Name | 2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanyl-N-(2-methylcyclohexyl)benzamide |
|---|---|
| PubChem CID | 112793176 |
| Molecular Formula | C23H34N2O2S |
| Molecular Weight | 402.60 g/mol |
| Exact Mass | 402.23 |
| IUPAC Name | 2-[2-(cyclohexylmethylamino)-2-oxoethyl]sulfanyl-N-(2-methylcyclohexyl)benzamide |
| SMILES | CC1CCCCC1NC(=O)c1ccccc1SCC(=O)NCC1CCCCC1 |
| InChI | InChI=1S/C23H34N2O2S/c1-17-9-5-7-13-20(17)25-23(27)19-12-6-8-14-21(19)28-16-22(26)24-15-18-10-3-2-4-11-18/h6,8,12,14,17-18,20H,2-5,7,9-11,13,15-16H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | SHLDEAKGDJOMFA-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |