C23H26ClN3O3S — CID 55333923
2-[2-[[(2-chlorobenzoyl)amino]carbamoyl]phenyl]sulfanyl-N-(cyclohexylmethyl)acetamide (PubChem CID 55333923) has the molecular formula C23H26ClN3O3S and a molecular weight of 460.00 g/mol. Its IUPAC name is 2-[2-[[(2-chlorobenzoyl)amino]carbamoyl]phenyl]sulfanyl-N-(cyclohexylmethyl)acetamide.
| Compound Name | 2-[2-[[(2-chlorobenzoyl)amino]carbamoyl]phenyl]sulfanyl-N-(cyclohexylmethyl)acetamide |
|---|---|
| PubChem CID | 55333923 |
| Molecular Formula | C23H26ClN3O3S |
| Molecular Weight | 460.00 g/mol |
| Exact Mass | 459.14 |
| IUPAC Name | 2-[2-[[(2-chlorobenzoyl)amino]carbamoyl]phenyl]sulfanyl-N-(cyclohexylmethyl)acetamide |
| SMILES | O=C(CSc1ccccc1C(=O)NNC(=O)c1ccccc1Cl)NCC1CCCCC1 |
| InChI | InChI=1S/C23H26ClN3O3S/c24-19-12-6-4-10-17(19)22(29)26-27-23(30)18-11-5-7-13-20(18)31-15-21(28)25-14-16-8-2-1-3-9-16/h4-7,10-13,16H,1-3,8-9,14-15H2,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | PBVGFAWRUIASLU-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.00 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|