C18H27NO2 — CID 46771593
N-cycloheptyl-2-(2,3-dimethylphenoxy)propanamide (PubChem CID 46771593) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is N-cycloheptyl-2-(2,3-dimethylphenoxy)propanamide.
| Compound Name | N-cycloheptyl-2-(2,3-dimethylphenoxy)propanamide |
|---|---|
| PubChem CID | 46771593 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | N-cycloheptyl-2-(2,3-dimethylphenoxy)propanamide |
| SMILES | Cc1cccc(OC(C)C(=O)NC2CCCCCC2)c1C |
| InChI | InChI=1S/C18H27NO2/c1-13-9-8-12-17(14(13)2)21-15(3)18(20)19-16-10-6-4-5-7-11-16/h8-9,12,15-16H,4-7,10-11H2,1-3H3,(H,19,20) |
| InChIKey | VWHYNVPELZUUML-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |