C18H27NO2 — CID 93488429
(2S)-N-cycloheptyl-2-(2-ethylphenoxy)propanamide (PubChem CID 93488429) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is (2S)-N-cycloheptyl-2-(2-ethylphenoxy)propanamide.
| Compound Name | (2S)-N-cycloheptyl-2-(2-ethylphenoxy)propanamide |
|---|---|
| PubChem CID | 93488429 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | (2S)-N-cycloheptyl-2-(2-ethylphenoxy)propanamide |
| SMILES | CCc1ccccc1O[C@@H](C)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C18H27NO2/c1-3-15-10-8-9-13-17(15)21-14(2)18(20)19-16-11-6-4-5-7-12-16/h8-10,13-14,16H,3-7,11-12H2,1-2H3,(H,19,20)/t14-/m0/s1 |
| InChIKey | USNSFQWXTJTBFH-AWEZNQCLSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |