C19H29NO2 — CID 43904274
N-cycloheptyl-2-(2-propan-2-ylphenoxy)propanamide (PubChem CID 43904274) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is N-cycloheptyl-2-(2-propan-2-ylphenoxy)propanamide.
| Compound Name | N-cycloheptyl-2-(2-propan-2-ylphenoxy)propanamide |
|---|---|
| PubChem CID | 43904274 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | N-cycloheptyl-2-(2-propan-2-ylphenoxy)propanamide |
| SMILES | CC(Oc1ccccc1C(C)C)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C19H29NO2/c1-14(2)17-12-8-9-13-18(17)22-15(3)19(21)20-16-10-6-4-5-7-11-16/h8-9,12-16H,4-7,10-11H2,1-3H3,(H,20,21) |
| InChIKey | FEMHENMJBVBAAF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |