C16H23NO3 — CID 107713127
N-cyclopentyl-2-[2-(2-hydroxyethyl)phenoxy]propanamide (PubChem CID 107713127) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is N-cyclopentyl-2-[2-(2-hydroxyethyl)phenoxy]propanamide.
| Compound Name | N-cyclopentyl-2-[2-(2-hydroxyethyl)phenoxy]propanamide |
|---|---|
| PubChem CID | 107713127 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-cyclopentyl-2-[2-(2-hydroxyethyl)phenoxy]propanamide |
| SMILES | CC(Oc1ccccc1CCO)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C16H23NO3/c1-12(16(19)17-14-7-3-4-8-14)20-15-9-5-2-6-13(15)10-11-18/h2,5-6,9,12,14,18H,3-4,7-8,10-11H2,1H3,(H,17,19) |
| InChIKey | CDDKILJSHMRWCG-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |