C20H31NO2 — CID 94027154
(2S)-N-cyclooctyl-2-(2,3-dimethylphenoxy)butanamide (PubChem CID 94027154) has the molecular formula C20H31NO2 and a molecular weight of 317.47 g/mol. Its IUPAC name is (2S)-N-cyclooctyl-2-(2,3-dimethylphenoxy)butanamide.
| Compound Name | (2S)-N-cyclooctyl-2-(2,3-dimethylphenoxy)butanamide |
|---|---|
| PubChem CID | 94027154 |
| Molecular Formula | C20H31NO2 |
| Molecular Weight | 317.47 g/mol |
| Exact Mass | 317.24 |
| IUPAC Name | (2S)-N-cyclooctyl-2-(2,3-dimethylphenoxy)butanamide |
| SMILES | CC[C@H](Oc1cccc(C)c1C)C(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C20H31NO2/c1-4-18(23-19-14-10-11-15(2)16(19)3)20(22)21-17-12-8-6-5-7-9-13-17/h10-11,14,17-18H,4-9,12-13H2,1-3H3,(H,21,22)/t18-/m0/s1 |
| InChIKey | NFKCALSBWNVYQL-SFHVURJKSA-N |
| XLogP | 4.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |