C19H29NO3 — CID 46769347
N-cyclooctyl-2-(3-methoxyphenoxy)butanamide (PubChem CID 46769347) has the molecular formula C19H29NO3 and a molecular weight of 319.44 g/mol. Its IUPAC name is N-cyclooctyl-2-(3-methoxyphenoxy)butanamide.
| Compound Name | N-cyclooctyl-2-(3-methoxyphenoxy)butanamide |
|---|---|
| PubChem CID | 46769347 |
| Molecular Formula | C19H29NO3 |
| Molecular Weight | 319.44 g/mol |
| Exact Mass | 319.21 |
| IUPAC Name | N-cyclooctyl-2-(3-methoxyphenoxy)butanamide |
| SMILES | CCC(Oc1cccc(OC)c1)C(=O)NC1CCCCCCC1 |
| InChI | InChI=1S/C19H29NO3/c1-3-18(23-17-13-9-12-16(14-17)22-2)19(21)20-15-10-7-5-4-6-8-11-15/h9,12-15,18H,3-8,10-11H2,1-2H3,(H,20,21) |
| InChIKey | YOUADNOTLZQDKF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.44 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |