C16H23NO4 — CID 92676854
(2S)-2-(3-methoxyphenoxy)-N-[[(2R)-oxolan-2-yl]methyl]butanamide (PubChem CID 92676854) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is (2S)-2-(3-methoxyphenoxy)-N-[[(2R)-oxolan-2-yl]methyl]butanamide.
| Compound Name | (2S)-2-(3-methoxyphenoxy)-N-[[(2R)-oxolan-2-yl]methyl]butanamide |
|---|---|
| PubChem CID | 92676854 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | (2S)-2-(3-methoxyphenoxy)-N-[[(2R)-oxolan-2-yl]methyl]butanamide |
| SMILES | CC[C@H](Oc1cccc(OC)c1)C(=O)NC[C@H]1CCCO1 |
| InChI | InChI=1S/C16H23NO4/c1-3-15(16(18)17-11-14-8-5-9-20-14)21-13-7-4-6-12(10-13)19-2/h4,6-7,10,14-15H,3,5,8-9,11H2,1-2H3,(H,17,18)/t14-,15+/m1/s1 |
| InChIKey | FQNUDGAGYUURNI-CABCVRRESA-N |
| XLogP | 2.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |