C23H28N2O5 — CID 28577313
2-[[(2R)-2-(3-methoxyphenoxy)butanoyl]amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 28577313) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is 2-[[(2R)-2-(3-methoxyphenoxy)butanoyl]amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 2-[[(2R)-2-(3-methoxyphenoxy)butanoyl]amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 28577313 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | 2-[[(2R)-2-(3-methoxyphenoxy)butanoyl]amino]-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | CC[C@@H](Oc1cccc(OC)c1)C(=O)Nc1ccccc1C(=O)NC[C@@H]1CCCO1 |
| InChI | InChI=1S/C23H28N2O5/c1-3-21(30-17-9-6-8-16(14-17)28-2)23(27)25-20-12-5-4-11-19(20)22(26)24-15-18-10-7-13-29-18/h4-6,8-9,11-12,14,18,21H,3,7,10,13,15H2,1-2H3,(H,24,26)(H,25,27)/t18-,21+/m0/s1 |
| InChIKey | ODNKFEBFZQODHN-GHTZIAJQSA-N |
| XLogP | 3.40 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |