C20H24FN3O5 — CID 7965115
(2R)-N'-[3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]-2-(4-fluorophenoxy)propanehydrazide (PubChem CID 7965115) has the molecular formula C20H24FN3O5 and a molecular weight of 405.43 g/mol. Its IUPAC name is (2R)-N'-[3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]-2-(4-fluorophenoxy)propanehydrazide.
| Compound Name | (2R)-N'-[3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]-2-(4-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 7965115 |
| Molecular Formula | C20H24FN3O5 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.17 |
| IUPAC Name | (2R)-N'-[3-[(3aS,7aR)-1,3-dioxo-3a,4,5,6,7,7a-hexahydroisoindol-2-yl]propanoyl]-2-(4-fluorophenoxy)propanehydrazide |
| SMILES | C[C@@H](Oc1ccc(F)cc1)C(=O)NNC(=O)CCN1C(=O)[C@H]2CCCC[C@H]2C1=O |
| InChI | InChI=1S/C20H24FN3O5/c1-12(29-14-8-6-13(21)7-9-14)18(26)23-22-17(25)10-11-24-19(27)15-4-2-3-5-16(15)20(24)28/h6-9,12,15-16H,2-5,10-11H2,1H3,(H,22,25)(H,23,26)/t12-,15-,16+/m1/s1 |
| InChIKey | WYCCMEXNOZEBOC-WQVCFCJDSA-N |
| XLogP | 1.31 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|