C15H19FN2O5 — CID 9091729
ethyl 4-[2-[(2S)-2-(4-fluorophenoxy)propanoyl]hydrazinyl]-4-oxobutanoate (PubChem CID 9091729) has the molecular formula C15H19FN2O5 and a molecular weight of 326.32 g/mol. Its IUPAC name is ethyl 4-[2-[(2S)-2-(4-fluorophenoxy)propanoyl]hydrazinyl]-4-oxobutanoate.
| Compound Name | ethyl 4-[2-[(2S)-2-(4-fluorophenoxy)propanoyl]hydrazinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 9091729 |
| Molecular Formula | C15H19FN2O5 |
| Molecular Weight | 326.32 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | ethyl 4-[2-[(2S)-2-(4-fluorophenoxy)propanoyl]hydrazinyl]-4-oxobutanoate |
| SMILES | CCOC(=O)CCC(=O)NNC(=O)[C@H](C)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C15H19FN2O5/c1-3-22-14(20)9-8-13(19)17-18-15(21)10(2)23-12-6-4-11(16)5-7-12/h4-7,10H,3,8-9H2,1-2H3,(H,17,19)(H,18,21)/t10-/m0/s1 |
| InChIKey | ONCGQFZCGIXDBQ-JTQLQIEISA-N |
| XLogP | 1.08 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.32 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|