C20H23FN2O5 — CID 9091757
(2S)-N'-[3-(3,5-dimethoxyphenyl)propanoyl]-2-(4-fluorophenoxy)propanehydrazide (PubChem CID 9091757) has the molecular formula C20H23FN2O5 and a molecular weight of 390.41 g/mol. Its IUPAC name is (2S)-N'-[3-(3,5-dimethoxyphenyl)propanoyl]-2-(4-fluorophenoxy)propanehydrazide.
| Compound Name | (2S)-N'-[3-(3,5-dimethoxyphenyl)propanoyl]-2-(4-fluorophenoxy)propanehydrazide |
|---|---|
| PubChem CID | 9091757 |
| Molecular Formula | C20H23FN2O5 |
| Molecular Weight | 390.41 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | (2S)-N'-[3-(3,5-dimethoxyphenyl)propanoyl]-2-(4-fluorophenoxy)propanehydrazide |
| SMILES | COc1cc(CCC(=O)NNC(=O)[C@H](C)Oc2ccc(F)cc2)cc(OC)c1 |
| InChI | InChI=1S/C20H23FN2O5/c1-13(28-16-7-5-15(21)6-8-16)20(25)23-22-19(24)9-4-14-10-17(26-2)12-18(11-14)27-3/h5-8,10-13H,4,9H2,1-3H3,(H,22,24)(H,23,25)/t13-/m0/s1 |
| InChIKey | LTWPEAHPPJSGGU-ZDUSSCGKSA-N |
| XLogP | 2.39 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.41 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|