C16H17FN2O3S — CID 43017930
2-(4-fluorophenoxy)-N'-(3-thiophen-3-ylpropanoyl)propanehydrazide (PubChem CID 43017930) has the molecular formula C16H17FN2O3S and a molecular weight of 336.39 g/mol. Its IUPAC name is 2-(4-fluorophenoxy)-N'-(3-thiophen-3-ylpropanoyl)propanehydrazide.
| Compound Name | 2-(4-fluorophenoxy)-N'-(3-thiophen-3-ylpropanoyl)propanehydrazide |
|---|---|
| PubChem CID | 43017930 |
| Molecular Formula | C16H17FN2O3S |
| Molecular Weight | 336.39 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 2-(4-fluorophenoxy)-N'-(3-thiophen-3-ylpropanoyl)propanehydrazide |
| SMILES | CC(Oc1ccc(F)cc1)C(=O)NNC(=O)CCc1ccsc1 |
| InChI | InChI=1S/C16H17FN2O3S/c1-11(22-14-5-3-13(17)4-6-14)16(21)19-18-15(20)7-2-12-8-9-23-10-12/h3-6,8-11H,2,7H2,1H3,(H,18,20)(H,19,21) |
| InChIKey | WZMFGQUDTBZVMW-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.39 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|