C18H28N4O4 — CID 9425353
[(2S,3S)-1-[2-[(2S)-2-(2,3-dimethylphenoxy)propanoyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea (PubChem CID 9425353) has the molecular formula C18H28N4O4 and a molecular weight of 364.45 g/mol. Its IUPAC name is [(2S,3S)-1-[2-[(2S)-2-(2,3-dimethylphenoxy)propanoyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea.
| Compound Name | [(2S,3S)-1-[2-[(2S)-2-(2,3-dimethylphenoxy)propanoyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 9425353 |
| Molecular Formula | C18H28N4O4 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.21 |
| IUPAC Name | [(2S,3S)-1-[2-[(2S)-2-(2,3-dimethylphenoxy)propanoyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea |
| SMILES | CC[C@H](C)[C@H](NC(N)=O)C(=O)NNC(=O)[C@H](C)Oc1cccc(C)c1C |
| InChI | InChI=1S/C18H28N4O4/c1-6-10(2)15(20-18(19)25)17(24)22-21-16(23)13(5)26-14-9-7-8-11(3)12(14)4/h7-10,13,15H,6H2,1-5H3,(H,21,23)(H,22,24)(H3,19,20,25)/t10-,13-,15-/m0/s1 |
| InChIKey | ZIJUUQTUMXODFB-XEGUGMAKSA-N |
| XLogP | 1.30 |
| TPSA | 122.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|