C15H23N5O2S — CID 7775008
[(2R,3S)-3-methyl-1-[2-[(2-methylphenyl)carbamothioyl]hydrazinyl]-1-oxopentan-2-yl]urea (PubChem CID 7775008) has the molecular formula C15H23N5O2S and a molecular weight of 337.45 g/mol. Its IUPAC name is [(2R,3S)-3-methyl-1-[2-[(2-methylphenyl)carbamothioyl]hydrazinyl]-1-oxopentan-2-yl]urea.
| Compound Name | [(2R,3S)-3-methyl-1-[2-[(2-methylphenyl)carbamothioyl]hydrazinyl]-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 7775008 |
| Molecular Formula | C15H23N5O2S |
| Molecular Weight | 337.45 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | [(2R,3S)-3-methyl-1-[2-[(2-methylphenyl)carbamothioyl]hydrazinyl]-1-oxopentan-2-yl]urea |
| SMILES | CC[C@H](C)[C@@H](NC(N)=O)C(=O)NNC(=S)Nc1ccccc1C |
| InChI | InChI=1S/C15H23N5O2S/c1-4-9(2)12(18-14(16)22)13(21)19-20-15(23)17-11-8-6-5-7-10(11)3/h5-9,12H,4H2,1-3H3,(H,19,21)(H3,16,18,22)(H2,17,20,23)/t9-,12+/m0/s1 |
| InChIKey | OOLXUBLLOMQEIX-JOYOIKCWSA-N |
| XLogP | 1.40 |
| TPSA | 108.28 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.45 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|