C14H19FN4O3 — CID 9037878
[(2S,3S)-1-[2-(4-fluorobenzoyl)hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea (PubChem CID 9037878) has the molecular formula C14H19FN4O3 and a molecular weight of 310.33 g/mol. Its IUPAC name is [(2S,3S)-1-[2-(4-fluorobenzoyl)hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea.
| Compound Name | [(2S,3S)-1-[2-(4-fluorobenzoyl)hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 9037878 |
| Molecular Formula | C14H19FN4O3 |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.14 |
| IUPAC Name | [(2S,3S)-1-[2-(4-fluorobenzoyl)hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea |
| SMILES | CC[C@H](C)[C@H](NC(N)=O)C(=O)NNC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C14H19FN4O3/c1-3-8(2)11(17-14(16)22)13(21)19-18-12(20)9-4-6-10(15)7-5-9/h4-8,11H,3H2,1-2H3,(H,18,20)(H,19,21)(H3,16,17,22)/t8-,11-/m0/s1 |
| InChIKey | OFSNCCYQLKPCKE-KWQFWETISA-N |
| XLogP | 0.67 |
| TPSA | 113.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|