C20H27N5O3 — CID 42905279
[1-[2-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea (PubChem CID 42905279) has the molecular formula C20H27N5O3 and a molecular weight of 385.47 g/mol. Its IUPAC name is [1-[2-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea.
| Compound Name | [1-[2-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea |
|---|---|
| PubChem CID | 42905279 |
| Molecular Formula | C20H27N5O3 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.21 |
| IUPAC Name | [1-[2-[4-(2,5-dimethylpyrrol-1-yl)benzoyl]hydrazinyl]-3-methyl-1-oxopentan-2-yl]urea |
| SMILES | CCC(C)C(NC(N)=O)C(=O)NNC(=O)c1ccc(-n2c(C)ccc2C)cc1 |
| InChI | InChI=1S/C20H27N5O3/c1-5-12(2)17(22-20(21)28)19(27)24-23-18(26)15-8-10-16(11-9-15)25-13(3)6-7-14(25)4/h6-12,17H,5H2,1-4H3,(H,23,26)(H,24,27)(H3,21,22,28) |
| InChIKey | ZVRDKOJDKONLJI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 118.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|