C16H20N2O — CID 41360035
4-(2,5-dimethylpyrrol-1-yl)-N-propan-2-ylbenzamide (PubChem CID 41360035) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-N-propan-2-ylbenzamide.
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-N-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 41360035 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-N-propan-2-ylbenzamide |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C16H20N2O/c1-11(2)17-16(19)14-7-9-15(10-8-14)18-12(3)5-6-13(18)4/h5-11H,1-4H3,(H,17,19) |
| InChIKey | KGSURSFRRRKAKE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|