C15H15F3N2O — CID 2576736
4-(2,5-dimethylpyrrol-1-yl)-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 2576736) has the molecular formula C15H15F3N2O and a molecular weight of 296.29 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 2576736 |
| Molecular Formula | C15H15F3N2O |
| Molecular Weight | 296.29 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)NCC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H15F3N2O/c1-10-3-4-11(2)20(10)13-7-5-12(6-8-13)14(21)19-9-15(16,17)18/h3-8H,9H2,1-2H3,(H,19,21) |
| InChIKey | BSZRBUALIRYXHV-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.29 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|