C16H21N3O3S — CID 36908727
4-(2,5-dimethylpyrrol-1-yl)-N-[2-(methanesulfonamido)ethyl]benzamide (PubChem CID 36908727) has the molecular formula C16H21N3O3S and a molecular weight of 335.43 g/mol. Its IUPAC name is 4-(2,5-dimethylpyrrol-1-yl)-N-[2-(methanesulfonamido)ethyl]benzamide.
| Compound Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[2-(methanesulfonamido)ethyl]benzamide |
|---|---|
| PubChem CID | 36908727 |
| Molecular Formula | C16H21N3O3S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.13 |
| IUPAC Name | 4-(2,5-dimethylpyrrol-1-yl)-N-[2-(methanesulfonamido)ethyl]benzamide |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)NCCNS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C16H21N3O3S/c1-12-4-5-13(2)19(12)15-8-6-14(7-9-15)16(20)17-10-11-18-23(3,21)22/h4-9,18H,10-11H2,1-3H3,(H,17,20) |
| InChIKey | KSDVFSZPRIXHLF-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 80.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|