C11H15ClN2O3S — CID 63663947
N-[2-(chloromethylsulfonylamino)ethyl]-4-methylbenzamide (PubChem CID 63663947) has the molecular formula C11H15ClN2O3S and a molecular weight of 290.77 g/mol. Its IUPAC name is N-[2-(chloromethylsulfonylamino)ethyl]-4-methylbenzamide.
| Compound Name | N-[2-(chloromethylsulfonylamino)ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 63663947 |
| Molecular Formula | C11H15ClN2O3S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | N-[2-(chloromethylsulfonylamino)ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNS(=O)(=O)CCl)cc1 |
| InChI | InChI=1S/C11H15ClN2O3S/c1-9-2-4-10(5-3-9)11(15)13-6-7-14-18(16,17)8-12/h2-5,14H,6-8H2,1H3,(H,13,15) |
| InChIKey | AWAQPHKLVYSYHI-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|