C30H36N4O3 — CID 15462667
N-[2-[bis[2-[(4-methylbenzoyl)amino]ethyl]amino]ethyl]-4-methylbenzamide (PubChem CID 15462667) has the molecular formula C30H36N4O3 and a molecular weight of 500.64 g/mol. Its IUPAC name is N-[2-[bis[2-[(4-methylbenzoyl)amino]ethyl]amino]ethyl]-4-methylbenzamide.
| Compound Name | N-[2-[bis[2-[(4-methylbenzoyl)amino]ethyl]amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 15462667 |
| Molecular Formula | C30H36N4O3 |
| Molecular Weight | 500.64 g/mol |
| Exact Mass | 500.28 |
| IUPAC Name | N-[2-[bis[2-[(4-methylbenzoyl)amino]ethyl]amino]ethyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCN(CCNC(=O)c2ccc(C)cc2)CCNC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C30H36N4O3/c1-22-4-10-25(11-5-22)28(35)31-16-19-34(20-17-32-29(36)26-12-6-23(2)7-13-26)21-18-33-30(37)27-14-8-24(3)9-15-27/h4-15H,16-21H2,1-3H3,(H,31,35)(H,32,36)(H,33,37) |
| InChIKey | YPQPXZZBJPEPLH-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |