C42H70N4O2 — CID 139954407
N-[2-[heptyl(pentyl)amino]ethyl]-4-[4-[2-[heptyl(pentyl)amino]ethylcarbamoyl]phenyl]benzamide (PubChem CID 139954407) has the molecular formula C42H70N4O2 and a molecular weight of 663.05 g/mol. Its IUPAC name is N-[2-[heptyl(pentyl)amino]ethyl]-4-[4-[2-[heptyl(pentyl)amino]ethylcarbamoyl]phenyl]benzamide.
| Compound Name | N-[2-[heptyl(pentyl)amino]ethyl]-4-[4-[2-[heptyl(pentyl)amino]ethylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 139954407 |
| Molecular Formula | C42H70N4O2 |
| Molecular Weight | 663.05 g/mol |
| Exact Mass | 662.55 |
| IUPAC Name | N-[2-[heptyl(pentyl)amino]ethyl]-4-[4-[2-[heptyl(pentyl)amino]ethylcarbamoyl]phenyl]benzamide |
| SMILES | CCCCCCCN(CCCCC)CCNC(=O)c1ccc(-c2ccc(C(=O)NCCN(CCCCC)CCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C42H70N4O2/c1-5-9-13-15-19-33-45(31-17-11-7-3)35-29-43-41(47)39-25-21-37(22-26-39)38-23-27-40(28-24-38)42(48)44-30-36-46(32-18-12-8-4)34-20-16-14-10-6-2/h21-28H,5-20,29-36H2,1-4H3,(H,43,47)(H,44,48) |
| InChIKey | IHBQEVCOBBPNEB-UHFFFAOYSA-N |
| XLogP | 9.74 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.05 |
| LogP ≤ 5 | 9.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|