C46H78N4O2 — CID 139955686
N-[3-[heptyl(hexyl)amino]propyl]-4-[4-[3-[heptyl(hexyl)amino]propylcarbamoyl]phenyl]benzamide (PubChem CID 139955686) has the molecular formula C46H78N4O2 and a molecular weight of 719.16 g/mol. Its IUPAC name is N-[3-[heptyl(hexyl)amino]propyl]-4-[4-[3-[heptyl(hexyl)amino]propylcarbamoyl]phenyl]benzamide.
| Compound Name | N-[3-[heptyl(hexyl)amino]propyl]-4-[4-[3-[heptyl(hexyl)amino]propylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 139955686 |
| Molecular Formula | C46H78N4O2 |
| Molecular Weight | 719.16 g/mol |
| Exact Mass | 718.61 |
| IUPAC Name | N-[3-[heptyl(hexyl)amino]propyl]-4-[4-[3-[heptyl(hexyl)amino]propylcarbamoyl]phenyl]benzamide |
| SMILES | CCCCCCCN(CCCCCC)CCCNC(=O)c1ccc(-c2ccc(C(=O)NCCCN(CCCCCC)CCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C46H78N4O2/c1-5-9-13-17-21-37-49(35-19-15-11-7-3)39-23-33-47-45(51)43-29-25-41(26-30-43)42-27-31-44(32-28-42)46(52)48-34-24-40-50(36-20-16-12-8-4)38-22-18-14-10-6-2/h25-32H,5-24,33-40H2,1-4H3,(H,47,51)(H,48,52) |
| InChIKey | QXHSCTBCXIYNCD-UHFFFAOYSA-N |
| XLogP | 11.30 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.16 |
| LogP ≤ 5 | 11.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|