C36H58N4O2 — CID 139954581
N-[3-(dibutylamino)propyl]-4-[4-[3-(dibutylamino)propylcarbamoyl]phenyl]benzamide (PubChem CID 139954581) has the molecular formula C36H58N4O2 and a molecular weight of 578.89 g/mol. Its IUPAC name is N-[3-(dibutylamino)propyl]-4-[4-[3-(dibutylamino)propylcarbamoyl]phenyl]benzamide.
| Compound Name | N-[3-(dibutylamino)propyl]-4-[4-[3-(dibutylamino)propylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 139954581 |
| Molecular Formula | C36H58N4O2 |
| Molecular Weight | 578.89 g/mol |
| Exact Mass | 578.46 |
| IUPAC Name | N-[3-(dibutylamino)propyl]-4-[4-[3-(dibutylamino)propylcarbamoyl]phenyl]benzamide |
| SMILES | CCCCN(CCCC)CCCNC(=O)c1ccc(-c2ccc(C(=O)NCCCN(CCCC)CCCC)cc2)cc1 |
| InChI | InChI=1S/C36H58N4O2/c1-5-9-25-39(26-10-6-2)29-13-23-37-35(41)33-19-15-31(16-20-33)32-17-21-34(22-18-32)36(42)38-24-14-30-40(27-11-7-3)28-12-8-4/h15-22H,5-14,23-30H2,1-4H3,(H,37,41)(H,38,42) |
| InChIKey | NETMXPMCXKFCTG-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.89 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|