C44H74N4O2 — CID 139955599
N-[3-[butyl(octyl)amino]propyl]-4-[4-[3-[butyl(octyl)amino]propylcarbamoyl]phenyl]benzamide (PubChem CID 139955599) has the molecular formula C44H74N4O2 and a molecular weight of 691.10 g/mol. Its IUPAC name is N-[3-[butyl(octyl)amino]propyl]-4-[4-[3-[butyl(octyl)amino]propylcarbamoyl]phenyl]benzamide.
| Compound Name | N-[3-[butyl(octyl)amino]propyl]-4-[4-[3-[butyl(octyl)amino]propylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 139955599 |
| Molecular Formula | C44H74N4O2 |
| Molecular Weight | 691.10 g/mol |
| Exact Mass | 690.58 |
| IUPAC Name | N-[3-[butyl(octyl)amino]propyl]-4-[4-[3-[butyl(octyl)amino]propylcarbamoyl]phenyl]benzamide |
| SMILES | CCCCCCCCN(CCCC)CCCNC(=O)c1ccc(-c2ccc(C(=O)NCCCN(CCCC)CCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C44H74N4O2/c1-5-9-13-15-17-19-35-47(33-11-7-3)37-21-31-45-43(49)41-27-23-39(24-28-41)40-25-29-42(30-26-40)44(50)46-32-22-38-48(34-12-8-4)36-20-18-16-14-10-6-2/h23-30H,5-22,31-38H2,1-4H3,(H,45,49)(H,46,50) |
| InChIKey | WXWUCVPBIJBZMB-UHFFFAOYSA-N |
| XLogP | 10.52 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.10 |
| LogP ≤ 5 | 10.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|