C50H86N4O2 — CID 139954884
N-[3-[heptyl(octyl)amino]propyl]-4-[4-[3-[heptyl(octyl)amino]propylcarbamoyl]phenyl]benzamide (PubChem CID 139954884) has the molecular formula C50H86N4O2 and a molecular weight of 775.26 g/mol. Its IUPAC name is N-[3-[heptyl(octyl)amino]propyl]-4-[4-[3-[heptyl(octyl)amino]propylcarbamoyl]phenyl]benzamide.
| Compound Name | N-[3-[heptyl(octyl)amino]propyl]-4-[4-[3-[heptyl(octyl)amino]propylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 139954884 |
| Molecular Formula | C50H86N4O2 |
| Molecular Weight | 775.26 g/mol |
| Exact Mass | 774.68 |
| IUPAC Name | N-[3-[heptyl(octyl)amino]propyl]-4-[4-[3-[heptyl(octyl)amino]propylcarbamoyl]phenyl]benzamide |
| SMILES | CCCCCCCCN(CCCCCCC)CCCNC(=O)c1ccc(-c2ccc(C(=O)NCCCN(CCCCCCC)CCCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C50H86N4O2/c1-5-9-13-17-21-25-41-53(39-23-19-15-11-7-3)43-27-37-51-49(55)47-33-29-45(30-34-47)46-31-35-48(36-32-46)50(56)52-38-28-44-54(40-24-20-16-12-8-4)42-26-22-18-14-10-6-2/h29-36H,5-28,37-44H2,1-4H3,(H,51,55)(H,52,56) |
| InChIKey | YDQJUZRGARXROD-UHFFFAOYSA-N |
| XLogP | 12.86 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 37 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 775.26 |
| LogP ≤ 5 | 12.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|