C40H66N4O2 — CID 139954652
N-[(dihexylamino)methyl]-4-[4-[(dihexylamino)methylcarbamoyl]phenyl]benzamide (PubChem CID 139954652) has the molecular formula C40H66N4O2 and a molecular weight of 634.99 g/mol. Its IUPAC name is N-[(dihexylamino)methyl]-4-[4-[(dihexylamino)methylcarbamoyl]phenyl]benzamide.
| Compound Name | N-[(dihexylamino)methyl]-4-[4-[(dihexylamino)methylcarbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 139954652 |
| Molecular Formula | C40H66N4O2 |
| Molecular Weight | 634.99 g/mol |
| Exact Mass | 634.52 |
| IUPAC Name | N-[(dihexylamino)methyl]-4-[4-[(dihexylamino)methylcarbamoyl]phenyl]benzamide |
| SMILES | CCCCCCN(CCCCCC)CNC(=O)c1ccc(-c2ccc(C(=O)NCN(CCCCCC)CCCCCC)cc2)cc1 |
| InChI | InChI=1S/C40H66N4O2/c1-5-9-13-17-29-43(30-18-14-10-6-2)33-41-39(45)37-25-21-35(22-26-37)36-23-27-38(28-24-36)40(46)42-34-44(31-19-15-11-7-3)32-20-16-12-8-4/h21-28H,5-20,29-34H2,1-4H3,(H,41,45)(H,42,46) |
| InChIKey | SSYIBYOPFXDEBE-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.99 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|