C19H33N3O — CID 143916257
(E)-but-2-en-2-amine;N-[2-[ethyl(propyl)amino]ethyl]-4-methylbenzamide (PubChem CID 143916257) has the molecular formula C19H33N3O and a molecular weight of 319.49 g/mol. Its IUPAC name is (E)-but-2-en-2-amine;N-[2-[ethyl(propyl)amino]ethyl]-4-methylbenzamide.
| Compound Name | (E)-but-2-en-2-amine;N-[2-[ethyl(propyl)amino]ethyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 143916257 |
| Molecular Formula | C19H33N3O |
| Molecular Weight | 319.49 g/mol |
| Exact Mass | 319.26 |
| IUPAC Name | (E)-but-2-en-2-amine;N-[2-[ethyl(propyl)amino]ethyl]-4-methylbenzamide |
| SMILES | C/C=C(\C)N.CCCN(CC)CCNC(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C15H24N2O.C4H9N/c1-4-11-17(5-2)12-10-16-15(18)14-8-6-13(3)7-9-14;1-3-4(2)5/h6-9H,4-5,10-12H2,1-3H3,(H,16,18);3H,5H2,1-2H3/b;4-3+ |
| InChIKey | GWKMFLYRCLZDBF-SCBDLNNBSA-N |
| XLogP | 3.33 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.49 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |