C13H22ClCuN3O — CID 70426685
4-amino-N-[2-(diethylamino)ethyl]benzamide;copper;hydrochloride (PubChem CID 70426685) has the molecular formula C13H22ClCuN3O and a molecular weight of 335.34 g/mol. Its IUPAC name is 4-amino-N-[2-(diethylamino)ethyl]benzamide;copper;hydrochloride.
| Compound Name | 4-amino-N-[2-(diethylamino)ethyl]benzamide;copper;hydrochloride |
|---|---|
| PubChem CID | 70426685 |
| Molecular Formula | C13H22ClCuN3O |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 4-amino-N-[2-(diethylamino)ethyl]benzamide;copper;hydrochloride |
| SMILES | CCN(CC)CCNC(=O)c1ccc(N)cc1.Cl.[Cu] |
| InChI | InChI=1S/C13H21N3O.ClH.Cu/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11;;/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17);1H; |
| InChIKey | RHXAKQSEFVCGHP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|