C13H21N3O — CID 171391868
4-amino-2,3,5,6-tetradeuterio-N-[2-(diethylamino)ethyl]benzamide (PubChem CID 171391868) has the molecular formula C13H21N3O and a molecular weight of 239.36 g/mol. Its IUPAC name is 4-amino-2,3,5,6-tetradeuterio-N-[2-(diethylamino)ethyl]benzamide.
| Compound Name | 4-amino-2,3,5,6-tetradeuterio-N-[2-(diethylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 171391868 |
| Molecular Formula | C13H21N3O |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.19 |
| IUPAC Name | 4-amino-2,3,5,6-tetradeuterio-N-[2-(diethylamino)ethyl]benzamide |
| SMILES | [2H]c1c([2H])c(C(=O)NCCN(CC)CC)c([2H])c([2H])c1N |
| InChI | InChI=1S/C13H21N3O/c1-3-16(4-2)10-9-15-13(17)11-5-7-12(14)8-6-11/h5-8H,3-4,9-10,14H2,1-2H3,(H,15,17)/i5D,6D,7D,8D |
| InChIKey | REQCZEXYDRLIBE-KDWZCNHSSA-N |
| XLogP | 1.34 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|