C13H21Cl2N3O — CID 117067963
3-amino-4-chloro-N-[2-(diethylamino)ethyl]benzamide;hydrochloride (PubChem CID 117067963) has the molecular formula C13H21Cl2N3O and a molecular weight of 306.24 g/mol. Its IUPAC name is 3-amino-4-chloro-N-[2-(diethylamino)ethyl]benzamide;hydrochloride.
| Compound Name | 3-amino-4-chloro-N-[2-(diethylamino)ethyl]benzamide;hydrochloride |
|---|---|
| PubChem CID | 117067963 |
| Molecular Formula | C13H21Cl2N3O |
| Molecular Weight | 306.24 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | 3-amino-4-chloro-N-[2-(diethylamino)ethyl]benzamide;hydrochloride |
| SMILES | CCN(CC)CCNC(=O)c1ccc(Cl)c(N)c1.Cl |
| InChI | InChI=1S/C13H20ClN3O.ClH/c1-3-17(4-2)8-7-16-13(18)10-5-6-11(14)12(15)9-10;/h5-6,9H,3-4,7-8,15H2,1-2H3,(H,16,18);1H |
| InChIKey | RESSTRDXYIGGDL-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|