C15H24ClN3O — CID 82546388
3-amino-4-chloro-N-[4-(diethylamino)butyl]benzamide (PubChem CID 82546388) has the molecular formula C15H24ClN3O and a molecular weight of 297.83 g/mol. Its IUPAC name is 3-amino-4-chloro-N-[4-(diethylamino)butyl]benzamide.
| Compound Name | 3-amino-4-chloro-N-[4-(diethylamino)butyl]benzamide |
|---|---|
| PubChem CID | 82546388 |
| Molecular Formula | C15H24ClN3O |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 3-amino-4-chloro-N-[4-(diethylamino)butyl]benzamide |
| SMILES | CCN(CC)CCCCNC(=O)c1ccc(Cl)c(N)c1 |
| InChI | InChI=1S/C15H24ClN3O/c1-3-19(4-2)10-6-5-9-18-15(20)12-7-8-13(16)14(17)11-12/h7-8,11H,3-6,9-10,17H2,1-2H3,(H,18,20) |
| InChIKey | SGQOIGIYMDLBHY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|