C17H29N3O2 — CID 93216760
3-amino-N-[3-(diethylamino)propyl]-4-propoxybenzamide (PubChem CID 93216760) has the molecular formula C17H29N3O2 and a molecular weight of 307.44 g/mol. Its IUPAC name is 3-amino-N-[3-(diethylamino)propyl]-4-propoxybenzamide.
| Compound Name | 3-amino-N-[3-(diethylamino)propyl]-4-propoxybenzamide |
|---|---|
| PubChem CID | 93216760 |
| Molecular Formula | C17H29N3O2 |
| Molecular Weight | 307.44 g/mol |
| Exact Mass | 307.23 |
| IUPAC Name | 3-amino-N-[3-(diethylamino)propyl]-4-propoxybenzamide |
| SMILES | CCCOc1ccc(C(=O)NCCCN(CC)CC)cc1N |
| InChI | InChI=1S/C17H29N3O2/c1-4-12-22-16-9-8-14(13-15(16)18)17(21)19-10-7-11-20(5-2)6-3/h8-9,13H,4-7,10-12,18H2,1-3H3,(H,19,21) |
| InChIKey | OYTMECJPUHAEEE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|