About 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride
2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride (PubChem CID 67947052) has the molecular formula C16H29Cl3N2O3
and a molecular weight of 403.78 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride |
| PubChem CID | 67947052 |
| Molecular Formula | C16H29Cl3N2O3 |
| Molecular Weight | 403.78 g/mol |
| Exact Mass | 402.12 |
| IUPAC Name | 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride |
| SMILES | CCCOc1ccc(C(=O)OCCN(CC)CC)cc1N.Cl.Cl.Cl |
| InChI | InChI=1S/C16H26N2O3.3ClH/c1-4-10-20-15-8-7-13(12-14(15)17)16(19)21-11-9-18(5-2)6-3;;;/h7-8,12H,4-6,9-11,17H2,1-3H3;3*1H |
| InChIKey | JOARHNHDLJHERV-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.78 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride (CID 67947052) is 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride is CCCOc1ccc(C(=O)OCCN(CC)CC)cc1N.Cl.Cl.Cl.
What is the InChIKey of 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride?
The InChIKey is JOARHNHDLJHERV-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N2O3.3ClH/c1-4-10-20-15-8-7-13(12-14(15)17)16(19)21-11-9-18(5-2)6-3;;;/h7-8,12H,4-6,9-11,17H2,1-3H3;3*1H.
What are the key properties of 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride?
2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride has a molecular weight of 403.78 g/mol, XLogP of 3.82, 9 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 3-amino-4-propoxybenzoate;trihydrochloride is sourced from PubChem (CID 67947052), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).