About 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride
2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride (PubChem CID 3083884) has the molecular formula C19H33ClN2O4
and a molecular weight of 388.94 g/mol. Its IUPAC name is 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride |
| PubChem CID | 3083884 |
| Molecular Formula | C19H33ClN2O4 |
| Molecular Weight | 388.94 g/mol |
| Exact Mass | 388.21 |
| IUPAC Name | 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride |
| SMILES | CCCCOc1ccc(C(=O)OCCOCCN(CC)CC)cc1N.Cl |
| InChI | InChI=1S/C19H32N2O4.ClH/c1-4-7-11-24-18-9-8-16(15-17(18)20)19(22)25-14-13-23-12-10-21(5-2)6-3;/h8-9,15H,4-7,10-14,20H2,1-3H3;1H |
| InChIKey | LHWHZGUJAWCAIQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.94 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride?
The IUPAC name of 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride (CID 3083884) is 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride.
What is the SMILES notation for 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride?
The canonical SMILES for 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride is CCCCOc1ccc(C(=O)OCCOCCN(CC)CC)cc1N.Cl.
What is the InChIKey of 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride?
The InChIKey is LHWHZGUJAWCAIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H32N2O4.ClH/c1-4-7-11-24-18-9-8-16(15-17(18)20)19(22)25-14-13-23-12-10-21(5-2)6-3;/h8-9,15H,4-7,10-14,20H2,1-3H3;1H.
What are the key properties of 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride?
2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride has a molecular weight of 388.94 g/mol, XLogP of 3.38, 13 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(diethylamino)ethoxy]ethyl 3-amino-4-butoxybenzoate;hydrochloride is sourced from PubChem (CID 3083884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).