About 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride
2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride (PubChem CID 2853546) has the molecular formula C14H22ClNO4
and a molecular weight of 303.79 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride |
| PubChem CID | 2853546 |
| Molecular Formula | C14H22ClNO4 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)c1ccc(OC)c(O)c1.Cl |
| InChI | InChI=1S/C14H21NO4.ClH/c1-4-15(5-2)8-9-19-14(17)11-6-7-13(18-3)12(16)10-11;/h6-7,10,16H,4-5,8-9H2,1-3H3;1H |
| InChIKey | FUPZCHDNIQEIAO-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride?
The IUPAC name of 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride (CID 2853546) is 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride.
What is the SMILES notation for 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride?
The canonical SMILES for 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride is CCN(CC)CCOC(=O)c1ccc(OC)c(O)c1.Cl.
What is the InChIKey of 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride?
The InChIKey is FUPZCHDNIQEIAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO4.ClH/c1-4-15(5-2)8-9-19-14(17)11-6-7-13(18-3)12(16)10-11;/h6-7,10,16H,4-5,8-9H2,1-3H3;1H.
What are the key properties of 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride?
2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride has a molecular weight of 303.79 g/mol, XLogP of 2.32, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(diethylamino)ethyl 3-hydroxy-4-methoxybenzoate;hydrochloride is sourced from PubChem (CID 2853546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).