C16H26ClNO5 — CID 54609530
2-(diethylamino)ethyl 2,3,4-trimethoxybenzoate;hydrochloride (PubChem CID 54609530) has the molecular formula C16H26ClNO5 and a molecular weight of 347.84 g/mol. Its IUPAC name is 2-(diethylamino)ethyl 2,3,4-trimethoxybenzoate;hydrochloride.
| Compound Name | 2-(diethylamino)ethyl 2,3,4-trimethoxybenzoate;hydrochloride |
|---|---|
| PubChem CID | 54609530 |
| Molecular Formula | C16H26ClNO5 |
| Molecular Weight | 347.84 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | 2-(diethylamino)ethyl 2,3,4-trimethoxybenzoate;hydrochloride |
| SMILES | CCN(CC)CCOC(=O)c1ccc(OC)c(OC)c1OC.Cl |
| InChI | InChI=1S/C16H25NO5.ClH/c1-6-17(7-2)10-11-22-16(18)12-8-9-13(19-3)15(21-5)14(12)20-4;/h8-9H,6-7,10-11H2,1-5H3;1H |
| InChIKey | KDYQDCKSGRBEFD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.84 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |